C31H44ClN3O7 — CID 91240112
[(4R)-7-chloro-1-[[(2S)-2-[[(8S)-8-[(2S)-5-methoxy-6-oxo-2,3-dihydropyran-2-yl]-6-methylnona-2,4,6-trienoyl]amino]-3,3-dimethylbutanoyl]amino]octa-1,6-dien-4-yl] carbamate (PubChem CID 91240112) has the molecular formula C31H44ClN3O7 and a molecular weight of 606.16 g/mol. Its IUPAC name is [(4R)-7-chloro-1-[[(2S)-2-[[(8S)-8-[(2S)-5-methoxy-6-oxo-2,3-dihydropyran-2-yl]-6-methylnona-2,4,6-trienoyl]amino]-3,3-dimethylbutanoyl]amino]octa-1,6-dien-4-yl] carbamate.
| Compound Name | [(4R)-7-chloro-1-[[(2S)-2-[[(8S)-8-[(2S)-5-methoxy-6-oxo-2,3-dihydropyran-2-yl]-6-methylnona-2,4,6-trienoyl]amino]-3,3-dimethylbutanoyl]amino]octa-1,6-dien-4-yl] carbamate |
|---|---|
| PubChem CID | 91240112 |
| Molecular Formula | C31H44ClN3O7 |
| Molecular Weight | 606.16 g/mol |
| Exact Mass | 605.29 |
| IUPAC Name | [(4R)-7-chloro-1-[[(2S)-2-[[(8S)-8-[(2S)-5-methoxy-6-oxo-2,3-dihydropyran-2-yl]-6-methylnona-2,4,6-trienoyl]amino]-3,3-dimethylbutanoyl]amino]octa-1,6-dien-4-yl] carbamate |
| SMILES | COC1=CC[C@@H]([C@@H](C)C=C(C)C=CC=CC(=O)N[C@H](C(=O)NC=CC[C@H](CC=C(C)Cl)OC(N)=O)C(C)(C)C)OC1=O |
| InChI | InChI=1S/C31H44ClN3O7/c1-20(19-21(2)24-16-17-25(40-7)29(38)42-24)11-8-9-13-26(36)35-27(31(4,5)6)28(37)34-18-10-12-23(41-30(33)39)15-14-22(3)32/h8-11,13-14,17-19,21,23-24,27H,12,15-16H2,1-7H3,(H2,33,39)(H,34,37)(H,35,36)/t21-,23+,24-,27+/m0/s1 |
| InChIKey | KRJDJEJEUDVRKZ-WCJVPVSSSA-N |
| XLogP | 5.07 |
| TPSA | 146.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.16 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|