C20H34F3NO2 — CID 24800898
2,2,2-trifluoro-N-[(E)-8-oxooctadec-9-enyl]acetamide (PubChem CID 24800898) has the molecular formula C20H34F3NO2 and a molecular weight of 377.49 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[(E)-8-oxooctadec-9-enyl]acetamide.
| Compound Name | 2,2,2-trifluoro-N-[(E)-8-oxooctadec-9-enyl]acetamide |
|---|---|
| PubChem CID | 24800898 |
| Molecular Formula | C20H34F3NO2 |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.25 |
| IUPAC Name | 2,2,2-trifluoro-N-[(E)-8-oxooctadec-9-enyl]acetamide |
| SMILES | CCCCCCCC/C=C/C(=O)CCCCCCCNC(=O)C(F)(F)F |
| InChI | InChI=1S/C20H34F3NO2/c1-2-3-4-5-6-7-9-12-15-18(25)16-13-10-8-11-14-17-24-19(26)20(21,22)23/h12,15H,2-11,13-14,16-17H2,1H3,(H,24,26)/b15-12+ |
| InChIKey | HUEBZDNBVZAAIJ-NTCAYCPXSA-N |
| XLogP | 5.88 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|