C25H29F3N4O6S2 — CID 24801618
N-[2-[4-[1-amino-2-(2,4,5-trifluorophenyl)ethyl]piperidin-1-yl]sulfonylethyl]-2-(1,3-dioxoisoindol-2-yl)ethanesulfonamide (PubChem CID 24801618) has the molecular formula C25H29F3N4O6S2 and a molecular weight of 602.66 g/mol. Its IUPAC name is N-[2-[4-[1-amino-2-(2,4,5-trifluorophenyl)ethyl]piperidin-1-yl]sulfonylethyl]-2-(1,3-dioxoisoindol-2-yl)ethanesulfonamide.
| Compound Name | N-[2-[4-[1-amino-2-(2,4,5-trifluorophenyl)ethyl]piperidin-1-yl]sulfonylethyl]-2-(1,3-dioxoisoindol-2-yl)ethanesulfonamide |
|---|---|
| PubChem CID | 24801618 |
| Molecular Formula | C25H29F3N4O6S2 |
| Molecular Weight | 602.66 g/mol |
| Exact Mass | 602.15 |
| IUPAC Name | N-[2-[4-[1-amino-2-(2,4,5-trifluorophenyl)ethyl]piperidin-1-yl]sulfonylethyl]-2-(1,3-dioxoisoindol-2-yl)ethanesulfonamide |
| SMILES | NC(Cc1cc(F)c(F)cc1F)C1CCN(S(=O)(=O)CCNS(=O)(=O)CCN2C(=O)c3ccccc3C2=O)CC1 |
| InChI | InChI=1S/C25H29F3N4O6S2/c26-20-15-22(28)21(27)13-17(20)14-23(29)16-5-8-31(9-6-16)40(37,38)11-7-30-39(35,36)12-10-32-24(33)18-3-1-2-4-19(18)25(32)34/h1-4,13,15-16,23,30H,5-12,14,29H2 |
| InChIKey | LTOWTGKZMCLDJN-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 146.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.66 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|