C20H19N3O2S — CID 24804195
(2-methylpyrrolidin-1-yl)-[2-(1-oxido-5-phenylpyridin-1-ium-2-yl)-1,3-thiazol-4-yl]methanone (PubChem CID 24804195) has the molecular formula C20H19N3O2S and a molecular weight of 365.46 g/mol. Its IUPAC name is (2-methylpyrrolidin-1-yl)-[2-(1-oxido-5-phenylpyridin-1-ium-2-yl)-1,3-thiazol-4-yl]methanone.
| Compound Name | (2-methylpyrrolidin-1-yl)-[2-(1-oxido-5-phenylpyridin-1-ium-2-yl)-1,3-thiazol-4-yl]methanone |
|---|---|
| PubChem CID | 24804195 |
| Molecular Formula | C20H19N3O2S |
| Molecular Weight | 365.46 g/mol |
| Exact Mass | 365.12 |
| IUPAC Name | (2-methylpyrrolidin-1-yl)-[2-(1-oxido-5-phenylpyridin-1-ium-2-yl)-1,3-thiazol-4-yl]methanone |
| SMILES | CC1CCCN1C(=O)c1csc(-c2ccc(-c3ccccc3)c[n+]2[O-])n1 |
| InChI | InChI=1S/C20H19N3O2S/c1-14-6-5-11-22(14)20(24)17-13-26-19(21-17)18-10-9-16(12-23(18)25)15-7-3-2-4-8-15/h2-4,7-10,12-14H,5-6,11H2,1H3 |
| InChIKey | XKFKOCQHTRWBJC-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 60.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.46 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|