C14H28ClN3 — CID 24805556
(2S)-1-(3-butylimidazol-1-ium-1-yl)-N,4-dimethylpentan-2-amine chloride (PubChem CID 24805556) has the molecular formula C14H28ClN3 and a molecular weight of 273.85 g/mol. Its IUPAC name is (2S)-1-(3-butylimidazol-1-ium-1-yl)-N,4-dimethylpentan-2-amine chloride.
| Compound Name | (2S)-1-(3-butylimidazol-1-ium-1-yl)-N,4-dimethylpentan-2-amine chloride |
|---|---|
| PubChem CID | 24805556 |
| Molecular Formula | C14H28ClN3 |
| Molecular Weight | 273.85 g/mol |
| Exact Mass | 273.20 |
| IUPAC Name | (2S)-1-(3-butylimidazol-1-ium-1-yl)-N,4-dimethylpentan-2-amine chloride |
| SMILES | CCCCn1cc[n+](C[C@H](CC(C)C)NC)c1.[Cl-] |
| InChI | InChI=1S/C14H28N3.ClH/c1-5-6-7-16-8-9-17(12-16)11-14(15-4)10-13(2)3;/h8-9,12-15H,5-7,10-11H2,1-4H3;1H/q+1;/p-1/t14-;/m0./s1 |
| InChIKey | NKRICHPJFFHMDS-UQKRIMTDSA-M |
| XLogP | -0.79 |
| TPSA | 20.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.85 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|