C10H20N2O5S — CID 24805553
(2S)-1-(3-butylimidazol-1-ium-1-yl)propan-2-ol;hydrogen sulfate (PubChem CID 24805553) has the molecular formula C10H20N2O5S and a molecular weight of 280.35 g/mol. Its IUPAC name is (2S)-1-(3-butylimidazol-1-ium-1-yl)propan-2-ol;hydrogen sulfate.
| Compound Name | (2S)-1-(3-butylimidazol-1-ium-1-yl)propan-2-ol;hydrogen sulfate |
|---|---|
| PubChem CID | 24805553 |
| Molecular Formula | C10H20N2O5S |
| Molecular Weight | 280.35 g/mol |
| Exact Mass | 280.11 |
| IUPAC Name | (2S)-1-(3-butylimidazol-1-ium-1-yl)propan-2-ol;hydrogen sulfate |
| SMILES | CCCCn1cc[n+](C[C@H](C)O)c1.O=S(=O)([O-])O |
| InChI | InChI=1S/C10H19N2O.H2O4S/c1-3-4-5-11-6-7-12(9-11)8-10(2)13;1-5(2,3)4/h6-7,9-10,13H,3-5,8H2,1-2H3;(H2,1,2,3,4)/q+1;/p-1/t10-;/m0./s1 |
| InChIKey | YWXUXOGUPVTUOE-PPHPATTJSA-M |
| XLogP | -0.04 |
| TPSA | 106.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.35 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|