C16H30N2O3 — CID 166679897
1-butyl-3-(2-ethylhexyl)imidazol-3-ium;hydron;carbonate (PubChem CID 166679897) has the molecular formula C16H30N2O3 and a molecular weight of 298.43 g/mol. Its IUPAC name is 1-butyl-3-(2-ethylhexyl)imidazol-3-ium;hydron;carbonate.
| Compound Name | 1-butyl-3-(2-ethylhexyl)imidazol-3-ium;hydron;carbonate |
|---|---|
| PubChem CID | 166679897 |
| Molecular Formula | C16H30N2O3 |
| Molecular Weight | 298.43 g/mol |
| Exact Mass | 298.23 |
| IUPAC Name | 1-butyl-3-(2-ethylhexyl)imidazol-3-ium;hydron;carbonate |
| SMILES | CCCCC(CC)C[n+]1ccn(CCCC)c1.O=C([O-])[O-].[H+] |
| InChI | InChI=1S/C15H29N2.CH2O3/c1-4-7-9-15(6-3)13-17-12-11-16(14-17)10-8-5-2;2-1(3)4/h11-12,14-15H,4-10,13H2,1-3H3;(H2,2,3,4)/q+1;/p-1 |
| InChIKey | IQCTTWCANSTJIY-UHFFFAOYSA-M |
| XLogP | 1.46 |
| TPSA | 72.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.43 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|