C19H37N2+ — CID 175551425
1-(2-ethylhexyl)-3-(2,3,3-trimethylpentan-2-yl)imidazol-1-ium (PubChem CID 175551425) has the molecular formula C19H37N2+ and a molecular weight of 293.52 g/mol. Its IUPAC name is 1-(2-ethylhexyl)-3-(2,3,3-trimethylpentan-2-yl)imidazol-1-ium.
| Compound Name | 1-(2-ethylhexyl)-3-(2,3,3-trimethylpentan-2-yl)imidazol-1-ium |
|---|---|
| PubChem CID | 175551425 |
| Molecular Formula | C19H37N2+ |
| Molecular Weight | 293.52 g/mol |
| Exact Mass | 293.30 |
| IUPAC Name | 1-(2-ethylhexyl)-3-(2,3,3-trimethylpentan-2-yl)imidazol-1-ium |
| SMILES | CCCCC(CC)C[n+]1ccn(C(C)(C)C(C)(C)CC)c1 |
| InChI | InChI=1S/C19H37N2/c1-8-11-12-17(9-2)15-20-13-14-21(16-20)19(6,7)18(4,5)10-3/h13-14,16-17H,8-12,15H2,1-7H3/q+1 |
| InChIKey | CAVXHZQBQXVUBD-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.52 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|