C34H60Br2N4 — CID 3049392
N-(2-ethylhexyl)-1-[8-[4-(2-ethylhexylamino)pyridin-1-ium-1-yl]octyl]pyridin-1-ium-4-amine dibromide (PubChem CID 3049392) has the molecular formula C34H60Br2N4 and a molecular weight of 684.69 g/mol. Its IUPAC name is N-(2-ethylhexyl)-1-[8-[4-(2-ethylhexylamino)pyridin-1-ium-1-yl]octyl]pyridin-1-ium-4-amine dibromide.
| Compound Name | N-(2-ethylhexyl)-1-[8-[4-(2-ethylhexylamino)pyridin-1-ium-1-yl]octyl]pyridin-1-ium-4-amine dibromide |
|---|---|
| PubChem CID | 3049392 |
| Molecular Formula | C34H60Br2N4 |
| Molecular Weight | 684.69 g/mol |
| Exact Mass | 682.32 |
| IUPAC Name | N-(2-ethylhexyl)-1-[8-[4-(2-ethylhexylamino)pyridin-1-ium-1-yl]octyl]pyridin-1-ium-4-amine dibromide |
| SMILES | CCCCC(CC)CNc1cc[n+](CCCCCCCC[n+]2ccc(NCC(CC)CCCC)cc2)cc1.[Br-].[Br-] |
| InChI | InChI=1S/C34H58N4.2BrH/c1-5-9-17-31(7-3)29-35-33-19-25-37(26-20-33)23-15-13-11-12-14-16-24-38-27-21-34(22-28-38)36-30-32(8-4)18-10-6-2;;/h19-22,25-28,31-32H,5-18,23-24,29-30H2,1-4H3;2*1H |
| InChIKey | HZIZESPPYQZSDH-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 31.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.69 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|