C13H25N3O3S — CID 24805954
N-[(2S)-1-(3-butylimidazol-1-ium-1-yl)-3-methylbutan-2-yl]-N-methylsulfamate (PubChem CID 24805954) has the molecular formula C13H25N3O3S and a molecular weight of 303.43 g/mol. Its IUPAC name is N-[(2S)-1-(3-butylimidazol-1-ium-1-yl)-3-methylbutan-2-yl]-N-methylsulfamate.
| Compound Name | N-[(2S)-1-(3-butylimidazol-1-ium-1-yl)-3-methylbutan-2-yl]-N-methylsulfamate |
|---|---|
| PubChem CID | 24805954 |
| Molecular Formula | C13H25N3O3S |
| Molecular Weight | 303.43 g/mol |
| Exact Mass | 303.16 |
| IUPAC Name | N-[(2S)-1-(3-butylimidazol-1-ium-1-yl)-3-methylbutan-2-yl]-N-methylsulfamate |
| SMILES | CCCCn1cc[n+](C[C@H](C(C)C)N(C)S(=O)(=O)[O-])c1 |
| InChI | InChI=1S/C13H25N3O3S/c1-5-6-7-15-8-9-16(11-15)10-13(12(2)3)14(4)20(17,18)19/h8-9,11-13H,5-7,10H2,1-4H3/t13-/m1/s1 |
| InChIKey | JXNKKXWXIDEMJN-CYBMUJFWSA-N |
| XLogP | 0.99 |
| TPSA | 69.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.43 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|