C12H13NO — CID 24808305
1-(2,5-dihydro-1-benzazepin-1-yl)ethanone (PubChem CID 24808305) has the molecular formula C12H13NO and a molecular weight of 187.24 g/mol. Its IUPAC name is 1-(2,5-dihydro-1-benzazepin-1-yl)ethanone.
| Compound Name | 1-(2,5-dihydro-1-benzazepin-1-yl)ethanone |
|---|---|
| PubChem CID | 24808305 |
| Molecular Formula | C12H13NO |
| Molecular Weight | 187.24 g/mol |
| Exact Mass | 187.10 |
| IUPAC Name | 1-(2,5-dihydro-1-benzazepin-1-yl)ethanone |
| SMILES | CC(=O)N1CC=CCc2ccccc21 |
| InChI | InChI=1S/C12H13NO/c1-10(14)13-9-5-4-7-11-6-2-3-8-12(11)13/h2-6,8H,7,9H2,1H3 |
| InChIKey | AQFRJAWVJFAMOL-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.24 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|