C18H14ClN5O3 — CID 24810847
(6-chloropyrazolo[1,5-a]pyrimidin-2-yl)-[4-(2-nitrophenyl)-3,6-dihydro-2H-pyridin-1-yl]methanone (PubChem CID 24810847) has the molecular formula C18H14ClN5O3 and a molecular weight of 383.80 g/mol. Its IUPAC name is (6-chloropyrazolo[1,5-a]pyrimidin-2-yl)-[4-(2-nitrophenyl)-3,6-dihydro-2H-pyridin-1-yl]methanone.
| Compound Name | (6-chloropyrazolo[1,5-a]pyrimidin-2-yl)-[4-(2-nitrophenyl)-3,6-dihydro-2H-pyridin-1-yl]methanone |
|---|---|
| PubChem CID | 24810847 |
| Molecular Formula | C18H14ClN5O3 |
| Molecular Weight | 383.80 g/mol |
| Exact Mass | 383.08 |
| IUPAC Name | (6-chloropyrazolo[1,5-a]pyrimidin-2-yl)-[4-(2-nitrophenyl)-3,6-dihydro-2H-pyridin-1-yl]methanone |
| SMILES | O=C(c1cc2ncc(Cl)cn2n1)N1CC=C(c2ccccc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C18H14ClN5O3/c19-13-10-20-17-9-15(21-23(17)11-13)18(25)22-7-5-12(6-8-22)14-3-1-2-4-16(14)24(26)27/h1-5,9-11H,6-8H2 |
| InChIKey | SYSYCYNUQVKFTI-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 93.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.80 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|