C17H13ClN4O3 — CID 68799749
(6-chloropyrazolo[1,5-a]pyridin-2-yl)-(5-nitro-3,4-dihydro-1H-isoquinolin-2-yl)methanone (PubChem CID 68799749) has the molecular formula C17H13ClN4O3 and a molecular weight of 356.77 g/mol. Its IUPAC name is (6-chloropyrazolo[1,5-a]pyridin-2-yl)-(5-nitro-3,4-dihydro-1H-isoquinolin-2-yl)methanone.
| Compound Name | (6-chloropyrazolo[1,5-a]pyridin-2-yl)-(5-nitro-3,4-dihydro-1H-isoquinolin-2-yl)methanone |
|---|---|
| PubChem CID | 68799749 |
| Molecular Formula | C17H13ClN4O3 |
| Molecular Weight | 356.77 g/mol |
| Exact Mass | 356.07 |
| IUPAC Name | (6-chloropyrazolo[1,5-a]pyridin-2-yl)-(5-nitro-3,4-dihydro-1H-isoquinolin-2-yl)methanone |
| SMILES | O=C(c1cc2ccc(Cl)cn2n1)N1CCc2c(cccc2[N+](=O)[O-])C1 |
| InChI | InChI=1S/C17H13ClN4O3/c18-12-4-5-13-8-15(19-21(13)10-12)17(23)20-7-6-14-11(9-20)2-1-3-16(14)22(24)25/h1-5,8,10H,6-7,9H2 |
| InChIKey | UFFJYCFQLANZCW-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.77 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|