C18H15N5O3 — CID 75390569
(5-nitro-3,4-dihydro-1H-isoquinolin-2-yl)-[4-(1,2,4-triazol-4-yl)phenyl]methanone (PubChem CID 75390569) has the molecular formula C18H15N5O3 and a molecular weight of 349.35 g/mol. Its IUPAC name is (5-nitro-3,4-dihydro-1H-isoquinolin-2-yl)-[4-(1,2,4-triazol-4-yl)phenyl]methanone.
| Compound Name | (5-nitro-3,4-dihydro-1H-isoquinolin-2-yl)-[4-(1,2,4-triazol-4-yl)phenyl]methanone |
|---|---|
| PubChem CID | 75390569 |
| Molecular Formula | C18H15N5O3 |
| Molecular Weight | 349.35 g/mol |
| Exact Mass | 349.12 |
| IUPAC Name | (5-nitro-3,4-dihydro-1H-isoquinolin-2-yl)-[4-(1,2,4-triazol-4-yl)phenyl]methanone |
| SMILES | O=C(c1ccc(-n2cnnc2)cc1)N1CCc2c(cccc2[N+](=O)[O-])C1 |
| InChI | InChI=1S/C18H15N5O3/c24-18(13-4-6-15(7-5-13)22-11-19-20-12-22)21-9-8-16-14(10-21)2-1-3-17(16)23(25)26/h1-7,11-12H,8-10H2 |
| InChIKey | MCWSPONMBXPFKM-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 94.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.35 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|