C7H6O4 — CID 24813368
(3aR,6aS)-3a,4,6,6a-tetrahydrocyclopenta[c]furan-1,3,5-trione (PubChem CID 24813368) has the molecular formula C7H6O4 and a molecular weight of 154.12 g/mol. Its IUPAC name is (3aR,6aS)-3a,4,6,6a-tetrahydrocyclopenta[c]furan-1,3,5-trione.
| Compound Name | (3aR,6aS)-3a,4,6,6a-tetrahydrocyclopenta[c]furan-1,3,5-trione |
|---|---|
| PubChem CID | 24813368 |
| Molecular Formula | C7H6O4 |
| Molecular Weight | 154.12 g/mol |
| Exact Mass | 154.03 |
| IUPAC Name | (3aR,6aS)-3a,4,6,6a-tetrahydrocyclopenta[c]furan-1,3,5-trione |
| SMILES | O=C1C[C@@H]2C(=O)OC(=O)[C@@H]2C1 |
| InChI | InChI=1S/C7H6O4/c8-3-1-4-5(2-3)7(10)11-6(4)9/h4-5H,1-2H2/t4-,5+ |
| InChIKey | FFLVRYHCHDGDPK-SYDPRGILSA-N |
| XLogP | -0.33 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.12 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|