C11H17IO4 — CID 24813511
methyl (1R,2R,4S)-2-[(E)-2-iodoethenyl]-4-(methoxymethoxy)cyclopentane-1-carboxylate (PubChem CID 24813511) has the molecular formula C11H17IO4 and a molecular weight of 340.16 g/mol. Its IUPAC name is methyl (1R,2R,4S)-2-[(E)-2-iodoethenyl]-4-(methoxymethoxy)cyclopentane-1-carboxylate.
| Compound Name | methyl (1R,2R,4S)-2-[(E)-2-iodoethenyl]-4-(methoxymethoxy)cyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 24813511 |
| Molecular Formula | C11H17IO4 |
| Molecular Weight | 340.16 g/mol |
| Exact Mass | 340.02 |
| IUPAC Name | methyl (1R,2R,4S)-2-[(E)-2-iodoethenyl]-4-(methoxymethoxy)cyclopentane-1-carboxylate |
| SMILES | COCO[C@H]1C[C@@H](/C=C/I)[C@H](C(=O)OC)C1 |
| InChI | InChI=1S/C11H17IO4/c1-14-7-16-9-5-8(3-4-12)10(6-9)11(13)15-2/h3-4,8-10H,5-7H2,1-2H3/b4-3+/t8-,9+,10-/m1/s1 |
| InChIKey | CUUNQGYGVSXSCL-DXQGWMINSA-N |
| XLogP | 2.12 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.16 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|