C9H13IO3 — CID 135038037
methyl (1R,2R,4S)-4-hydroxy-2-[(E)-2-iodoethenyl]cyclopentane-1-carboxylate (PubChem CID 135038037) has the molecular formula C9H13IO3 and a molecular weight of 296.10 g/mol. Its IUPAC name is methyl (1R,2R,4S)-4-hydroxy-2-[(E)-2-iodoethenyl]cyclopentane-1-carboxylate.
| Compound Name | methyl (1R,2R,4S)-4-hydroxy-2-[(E)-2-iodoethenyl]cyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 135038037 |
| Molecular Formula | C9H13IO3 |
| Molecular Weight | 296.10 g/mol |
| Exact Mass | 295.99 |
| IUPAC Name | methyl (1R,2R,4S)-4-hydroxy-2-[(E)-2-iodoethenyl]cyclopentane-1-carboxylate |
| SMILES | COC(=O)[C@@H]1C[C@@H](O)C[C@H]1/C=C/I |
| InChI | InChI=1S/C9H13IO3/c1-13-9(12)8-5-7(11)4-6(8)2-3-10/h2-3,6-8,11H,4-5H2,1H3/b3-2+/t6-,7+,8-/m1/s1 |
| InChIKey | OFFTUIRPAQHQCY-HRDOHYJMSA-N |
| XLogP | 1.50 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.10 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|