C33H38N2O4 — CID 24813771
ditert-butyl (2E,6E)-4,4-dicyano-2,6-bis[(2-methylphenyl)methylidene]heptanedioate (PubChem CID 24813771) has the molecular formula C33H38N2O4 and a molecular weight of 526.68 g/mol. Its IUPAC name is ditert-butyl (2E,6E)-4,4-dicyano-2,6-bis[(2-methylphenyl)methylidene]heptanedioate.
| Compound Name | ditert-butyl (2E,6E)-4,4-dicyano-2,6-bis[(2-methylphenyl)methylidene]heptanedioate |
|---|---|
| PubChem CID | 24813771 |
| Molecular Formula | C33H38N2O4 |
| Molecular Weight | 526.68 g/mol |
| Exact Mass | 526.28 |
| IUPAC Name | ditert-butyl (2E,6E)-4,4-dicyano-2,6-bis[(2-methylphenyl)methylidene]heptanedioate |
| SMILES | Cc1ccccc1/C=C(\CC(C#N)(C#N)C/C(=C\c1ccccc1C)C(=O)OC(C)(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C33H38N2O4/c1-23-13-9-11-15-25(23)17-27(29(36)38-31(3,4)5)19-33(21-34,22-35)20-28(30(37)39-32(6,7)8)18-26-16-12-10-14-24(26)2/h9-18H,19-20H2,1-8H3/b27-17+,28-18+ |
| InChIKey | UHLTXZIXUKTSDL-XUIWWLCJSA-N |
| XLogP | 7.27 |
| TPSA | 100.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.68 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|