About (2Z)-3,3-dimethyl-2-[(2-methylphenyl)methylidene]butan-1-ol
(2Z)-3,3-dimethyl-2-[(2-methylphenyl)methylidene]butan-1-ol (PubChem CID 115023712) has the molecular formula C14H20O
and a molecular weight of 204.31 g/mol. Its IUPAC name is (2Z)-3,3-dimethyl-2-[(2-methylphenyl)methylidene]butan-1-ol.
Molecular Properties
| Compound Name | (2Z)-3,3-dimethyl-2-[(2-methylphenyl)methylidene]butan-1-ol |
| PubChem CID | 115023712 |
| Molecular Formula | C14H20O |
| Molecular Weight | 204.31 g/mol |
| Exact Mass | 204.15 |
| IUPAC Name | (2Z)-3,3-dimethyl-2-[(2-methylphenyl)methylidene]butan-1-ol |
| SMILES | Cc1ccccc1/C=C(\CO)C(C)(C)C |
| InChI | InChI=1S/C14H20O/c1-11-7-5-6-8-12(11)9-13(10-15)14(2,3)4/h5-9,15H,10H2,1-4H3/b13-9+ |
| InChIKey | ZBGQPXNQCIPIMB-UKTHLTGXSA-N |
| XLogP | 3.42 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.31 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (2Z)-3,3-dimethyl-2-[(2-methylphenyl)methylidene]butan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z)-3,3-dimethyl-2-[(2-methylphenyl)methylidene]butan-1-ol?
The IUPAC name of (2Z)-3,3-dimethyl-2-[(2-methylphenyl)methylidene]butan-1-ol (CID 115023712) is (2Z)-3,3-dimethyl-2-[(2-methylphenyl)methylidene]butan-1-ol.
What is the SMILES notation for (2Z)-3,3-dimethyl-2-[(2-methylphenyl)methylidene]butan-1-ol?
The canonical SMILES for (2Z)-3,3-dimethyl-2-[(2-methylphenyl)methylidene]butan-1-ol is Cc1ccccc1/C=C(\CO)C(C)(C)C.
What is the InChIKey of (2Z)-3,3-dimethyl-2-[(2-methylphenyl)methylidene]butan-1-ol?
The InChIKey is ZBGQPXNQCIPIMB-UKTHLTGXSA-N. The full InChI is InChI=1S/C14H20O/c1-11-7-5-6-8-12(11)9-13(10-15)14(2,3)4/h5-9,15H,10H2,1-4H3/b13-9+.
What are the key properties of (2Z)-3,3-dimethyl-2-[(2-methylphenyl)methylidene]butan-1-ol?
(2Z)-3,3-dimethyl-2-[(2-methylphenyl)methylidene]butan-1-ol has a molecular weight of 204.31 g/mol, XLogP of 3.42, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z)-3,3-dimethyl-2-[(2-methylphenyl)methylidene]butan-1-ol is sourced from PubChem (CID 115023712), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).