C13H21O7P — CID 24814601
[(1R,5S)-5-hydroxy-5-methyl-4-oxocyclohex-2-en-1-yl] 2-diethoxyphosphorylacetate (PubChem CID 24814601) has the molecular formula C13H21O7P and a molecular weight of 320.28 g/mol. Its IUPAC name is [(1R,5S)-5-hydroxy-5-methyl-4-oxocyclohex-2-en-1-yl] 2-diethoxyphosphorylacetate.
| Compound Name | [(1R,5S)-5-hydroxy-5-methyl-4-oxocyclohex-2-en-1-yl] 2-diethoxyphosphorylacetate |
|---|---|
| PubChem CID | 24814601 |
| Molecular Formula | C13H21O7P |
| Molecular Weight | 320.28 g/mol |
| Exact Mass | 320.10 |
| IUPAC Name | [(1R,5S)-5-hydroxy-5-methyl-4-oxocyclohex-2-en-1-yl] 2-diethoxyphosphorylacetate |
| SMILES | CCOP(=O)(CC(=O)O[C@H]1C=CC(=O)[C@@](C)(O)C1)OCC |
| InChI | InChI=1S/C13H21O7P/c1-4-18-21(17,19-5-2)9-12(15)20-10-6-7-11(14)13(3,16)8-10/h6-7,10,16H,4-5,8-9H2,1-3H3/t10-,13-/m0/s1 |
| InChIKey | MXWFEVNJEDMYNL-GWCFXTLKSA-N |
| XLogP | 1.44 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.28 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|