C11H20NO5P — CID 15213142
3-diethoxyphosphoryl-1-pyrrolidin-1-ylpropane-1,2-dione (PubChem CID 15213142) has the molecular formula C11H20NO5P and a molecular weight of 277.26 g/mol. Its IUPAC name is 3-diethoxyphosphoryl-1-pyrrolidin-1-ylpropane-1,2-dione.
| Compound Name | 3-diethoxyphosphoryl-1-pyrrolidin-1-ylpropane-1,2-dione |
|---|---|
| PubChem CID | 15213142 |
| Molecular Formula | C11H20NO5P |
| Molecular Weight | 277.26 g/mol |
| Exact Mass | 277.11 |
| IUPAC Name | 3-diethoxyphosphoryl-1-pyrrolidin-1-ylpropane-1,2-dione |
| SMILES | CCOP(=O)(CC(=O)C(=O)N1CCCC1)OCC |
| InChI | InChI=1S/C11H20NO5P/c1-3-16-18(15,17-4-2)9-10(13)11(14)12-7-5-6-8-12/h3-9H2,1-2H3 |
| InChIKey | KHOTUGQCUDXGBE-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.26 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|