C10H21O8PS — CID 90003405
(2,2-dihydroxyoxathian-4-yl) 2-diethoxyphosphorylacetate (PubChem CID 90003405) has the molecular formula C10H21O8PS and a molecular weight of 332.31 g/mol. Its IUPAC name is (2,2-dihydroxyoxathian-4-yl) 2-diethoxyphosphorylacetate.
| Compound Name | (2,2-dihydroxyoxathian-4-yl) 2-diethoxyphosphorylacetate |
|---|---|
| PubChem CID | 90003405 |
| Molecular Formula | C10H21O8PS |
| Molecular Weight | 332.31 g/mol |
| Exact Mass | 332.07 |
| IUPAC Name | (2,2-dihydroxyoxathian-4-yl) 2-diethoxyphosphorylacetate |
| SMILES | CCOP(=O)(CC(=O)OC1CCOS(O)(O)C1)OCC |
| InChI | InChI=1S/C10H21O8PS/c1-3-15-19(12,16-4-2)7-10(11)18-9-5-6-17-20(13,14)8-9/h9,13-14H,3-8H2,1-2H3 |
| InChIKey | BCNZUYAYYJDHLG-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.31 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|