C19H21F3N2O4S — CID 24816089
N-[4-(4-ethylmorpholin-2-yl)phenyl]-2-(trifluoromethoxy)benzenesulfonamide (PubChem CID 24816089) has the molecular formula C19H21F3N2O4S and a molecular weight of 430.45 g/mol. Its IUPAC name is N-[4-(4-ethylmorpholin-2-yl)phenyl]-2-(trifluoromethoxy)benzenesulfonamide.
| Compound Name | N-[4-(4-ethylmorpholin-2-yl)phenyl]-2-(trifluoromethoxy)benzenesulfonamide |
|---|---|
| PubChem CID | 24816089 |
| Molecular Formula | C19H21F3N2O4S |
| Molecular Weight | 430.45 g/mol |
| Exact Mass | 430.12 |
| IUPAC Name | N-[4-(4-ethylmorpholin-2-yl)phenyl]-2-(trifluoromethoxy)benzenesulfonamide |
| SMILES | CCN1CCOC(c2ccc(NS(=O)(=O)c3ccccc3OC(F)(F)F)cc2)C1 |
| InChI | InChI=1S/C19H21F3N2O4S/c1-2-24-11-12-27-17(13-24)14-7-9-15(10-8-14)23-29(25,26)18-6-4-3-5-16(18)28-19(20,21)22/h3-10,17,23H,2,11-13H2,1H3 |
| InChIKey | OMKOHCPJXVWVSB-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.45 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |