C18H21ClN2O3S — CID 24816093
4-chloro-N-[4-(4-ethylmorpholin-2-yl)phenyl]benzenesulfonamide (PubChem CID 24816093) has the molecular formula C18H21ClN2O3S and a molecular weight of 380.90 g/mol. Its IUPAC name is 4-chloro-N-[4-(4-ethylmorpholin-2-yl)phenyl]benzenesulfonamide.
| Compound Name | 4-chloro-N-[4-(4-ethylmorpholin-2-yl)phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 24816093 |
| Molecular Formula | C18H21ClN2O3S |
| Molecular Weight | 380.90 g/mol |
| Exact Mass | 380.10 |
| IUPAC Name | 4-chloro-N-[4-(4-ethylmorpholin-2-yl)phenyl]benzenesulfonamide |
| SMILES | CCN1CCOC(c2ccc(NS(=O)(=O)c3ccc(Cl)cc3)cc2)C1 |
| InChI | InChI=1S/C18H21ClN2O3S/c1-2-21-11-12-24-18(13-21)14-3-7-16(8-4-14)20-25(22,23)17-9-5-15(19)6-10-17/h3-10,18,20H,2,11-13H2,1H3 |
| InChIKey | LTIXELDEHIBRNR-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.90 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |