C20H25N6O6P — CID 24822594
[(2R,3S,5R)-5-(6-amino-8-phenylpurin-9-yl)-3-hydroxyoxolan-2-yl]methoxy-morpholin-4-ylphosphinic acid (PubChem CID 24822594) has the molecular formula C20H25N6O6P and a molecular weight of 476.43 g/mol. Its IUPAC name is [(2R,3S,5R)-5-(6-amino-8-phenylpurin-9-yl)-3-hydroxyoxolan-2-yl]methoxy-morpholin-4-ylphosphinic acid.
| Compound Name | [(2R,3S,5R)-5-(6-amino-8-phenylpurin-9-yl)-3-hydroxyoxolan-2-yl]methoxy-morpholin-4-ylphosphinic acid |
|---|---|
| PubChem CID | 24822594 |
| Molecular Formula | C20H25N6O6P |
| Molecular Weight | 476.43 g/mol |
| Exact Mass | 476.16 |
| IUPAC Name | [(2R,3S,5R)-5-(6-amino-8-phenylpurin-9-yl)-3-hydroxyoxolan-2-yl]methoxy-morpholin-4-ylphosphinic acid |
| SMILES | Nc1ncnc2c1nc(-c1ccccc1)n2[C@H]1C[C@H](O)[C@@H](COP(=O)(O)N2CCOCC2)O1 |
| InChI | InChI=1S/C20H25N6O6P/c21-18-17-20(23-12-22-18)26(19(24-17)13-4-2-1-3-5-13)16-10-14(27)15(32-16)11-31-33(28,29)25-6-8-30-9-7-25/h1-5,12,14-16,27H,6-11H2,(H,28,29)(H2,21,22,23)/t14-,15+,16+/m0/s1 |
| InChIKey | MNUNMVVYRGJMKU-ARFHVFGLSA-N |
| XLogP | 1.17 |
| TPSA | 158.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.43 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|