C18H32INO4 — CID 24824419
tert-butyl (4R,5S)-5-[(E,2S,3R,4R)-3-hydroxy-6-iodo-4-methylhex-5-en-2-yl]-2,2,4-trimethyl-1,3-oxazolidine-3-carboxylate (PubChem CID 24824419) has the molecular formula C18H32INO4 and a molecular weight of 453.36 g/mol. Its IUPAC name is tert-butyl (4R,5S)-5-[(E,2S,3R,4R)-3-hydroxy-6-iodo-4-methylhex-5-en-2-yl]-2,2,4-trimethyl-1,3-oxazolidine-3-carboxylate.
| Compound Name | tert-butyl (4R,5S)-5-[(E,2S,3R,4R)-3-hydroxy-6-iodo-4-methylhex-5-en-2-yl]-2,2,4-trimethyl-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 24824419 |
| Molecular Formula | C18H32INO4 |
| Molecular Weight | 453.36 g/mol |
| Exact Mass | 453.14 |
| IUPAC Name | tert-butyl (4R,5S)-5-[(E,2S,3R,4R)-3-hydroxy-6-iodo-4-methylhex-5-en-2-yl]-2,2,4-trimethyl-1,3-oxazolidine-3-carboxylate |
| SMILES | C[C@@H]([C@H](O)[C@H](C)/C=C/I)[C@@H]1OC(C)(C)N(C(=O)OC(C)(C)C)[C@@H]1C |
| InChI | InChI=1S/C18H32INO4/c1-11(9-10-19)14(21)12(2)15-13(3)20(18(7,8)23-15)16(22)24-17(4,5)6/h9-15,21H,1-8H3/b10-9+/t11-,12+,13-,14-,15+/m1/s1 |
| InChIKey | XZRMHDANYQRDEA-OIKSBZNYSA-N |
| XLogP | 4.33 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.36 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|