C24H47NO4Si — CID 134940881
tert-butyl (4R,5S)-2,2,4-trimethyl-5-[(2R,3R,4R)-4-methyl-3-triethylsilyloxyhex-5-en-2-yl]-1,3-oxazolidine-3-carboxylate (PubChem CID 134940881) has the molecular formula C24H47NO4Si and a molecular weight of 441.73 g/mol. Its IUPAC name is tert-butyl (4R,5S)-2,2,4-trimethyl-5-[(2R,3R,4R)-4-methyl-3-triethylsilyloxyhex-5-en-2-yl]-1,3-oxazolidine-3-carboxylate.
| Compound Name | tert-butyl (4R,5S)-2,2,4-trimethyl-5-[(2R,3R,4R)-4-methyl-3-triethylsilyloxyhex-5-en-2-yl]-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 134940881 |
| Molecular Formula | C24H47NO4Si |
| Molecular Weight | 441.73 g/mol |
| Exact Mass | 441.33 |
| IUPAC Name | tert-butyl (4R,5S)-2,2,4-trimethyl-5-[(2R,3R,4R)-4-methyl-3-triethylsilyloxyhex-5-en-2-yl]-1,3-oxazolidine-3-carboxylate |
| SMILES | C=C[C@@H](C)[C@@H](O[Si](CC)(CC)CC)[C@H](C)[C@@H]1OC(C)(C)N(C(=O)OC(C)(C)C)[C@@H]1C |
| InChI | InChI=1S/C24H47NO4Si/c1-13-17(5)20(29-30(14-2,15-3)16-4)18(6)21-19(7)25(24(11,12)27-21)22(26)28-23(8,9)10/h13,17-21H,1,14-16H2,2-12H3/t17-,18+,19-,20-,21+/m1/s1 |
| InChIKey | SALULDGNDGFNIN-XNTOXWQXSA-N |
| XLogP | 6.60 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.73 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|