C18H15F3N4O2 — CID 24825153
5-ethyl-1-phenyl-N-[2-(trifluoromethoxy)phenyl]triazole-4-carboxamide (PubChem CID 24825153) has the molecular formula C18H15F3N4O2 and a molecular weight of 376.34 g/mol. Its IUPAC name is 5-ethyl-1-phenyl-N-[2-(trifluoromethoxy)phenyl]triazole-4-carboxamide.
| Compound Name | 5-ethyl-1-phenyl-N-[2-(trifluoromethoxy)phenyl]triazole-4-carboxamide |
|---|---|
| PubChem CID | 24825153 |
| Molecular Formula | C18H15F3N4O2 |
| Molecular Weight | 376.34 g/mol |
| Exact Mass | 376.11 |
| IUPAC Name | 5-ethyl-1-phenyl-N-[2-(trifluoromethoxy)phenyl]triazole-4-carboxamide |
| SMILES | CCc1c(C(=O)Nc2ccccc2OC(F)(F)F)nnn1-c1ccccc1 |
| InChI | InChI=1S/C18H15F3N4O2/c1-2-14-16(23-24-25(14)12-8-4-3-5-9-12)17(26)22-13-10-6-7-11-15(13)27-18(19,20)21/h3-11H,2H2,1H3,(H,22,26) |
| InChIKey | JEEFDYSUYYXLJC-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.34 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |