C22H14F3N3O3 — CID 35202250
4-oxo-3-phenyl-N-[2-(trifluoromethoxy)phenyl]phthalazine-1-carboxamide (PubChem CID 35202250) has the molecular formula C22H14F3N3O3 and a molecular weight of 425.37 g/mol. Its IUPAC name is 4-oxo-3-phenyl-N-[2-(trifluoromethoxy)phenyl]phthalazine-1-carboxamide.
| Compound Name | 4-oxo-3-phenyl-N-[2-(trifluoromethoxy)phenyl]phthalazine-1-carboxamide |
|---|---|
| PubChem CID | 35202250 |
| Molecular Formula | C22H14F3N3O3 |
| Molecular Weight | 425.37 g/mol |
| Exact Mass | 425.10 |
| IUPAC Name | 4-oxo-3-phenyl-N-[2-(trifluoromethoxy)phenyl]phthalazine-1-carboxamide |
| SMILES | O=C(Nc1ccccc1OC(F)(F)F)c1nn(-c2ccccc2)c(=O)c2ccccc12 |
| InChI | InChI=1S/C22H14F3N3O3/c23-22(24,25)31-18-13-7-6-12-17(18)26-20(29)19-15-10-4-5-11-16(15)21(30)28(27-19)14-8-2-1-3-9-14/h1-13H,(H,26,29) |
| InChIKey | UXGSUJSIIPXDCO-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.37 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |