C35H35Cl2N5O — CID 24825767
2-(2-chlorophenyl)-1-(4-chlorophenyl)-5-ethyl-N-[4-(1,2,3,4-tetrahydroacridin-9-ylamino)butyl]imidazole-4-carboxamide (PubChem CID 24825767) has the molecular formula C35H35Cl2N5O and a molecular weight of 612.61 g/mol. Its IUPAC name is 2-(2-chlorophenyl)-1-(4-chlorophenyl)-5-ethyl-N-[4-(1,2,3,4-tetrahydroacridin-9-ylamino)butyl]imidazole-4-carboxamide.
| Compound Name | 2-(2-chlorophenyl)-1-(4-chlorophenyl)-5-ethyl-N-[4-(1,2,3,4-tetrahydroacridin-9-ylamino)butyl]imidazole-4-carboxamide |
|---|---|
| PubChem CID | 24825767 |
| Molecular Formula | C35H35Cl2N5O |
| Molecular Weight | 612.61 g/mol |
| Exact Mass | 611.22 |
| IUPAC Name | 2-(2-chlorophenyl)-1-(4-chlorophenyl)-5-ethyl-N-[4-(1,2,3,4-tetrahydroacridin-9-ylamino)butyl]imidazole-4-carboxamide |
| SMILES | CCc1c(C(=O)NCCCCNc2c3c(nc4ccccc24)CCCC3)nc(-c2ccccc2Cl)n1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C35H35Cl2N5O/c1-2-31-33(41-34(25-11-3-6-14-28(25)37)42(31)24-19-17-23(36)18-20-24)35(43)39-22-10-9-21-38-32-26-12-4-7-15-29(26)40-30-16-8-5-13-27(30)32/h3-4,6-7,11-12,14-15,17-20H,2,5,8-10,13,16,21-22H2,1H3,(H,38,40)(H,39,43) |
| InChIKey | STWYWUGMZLRNAY-UHFFFAOYSA-N |
| XLogP | 8.46 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.61 |
| LogP ≤ 5 | 8.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|