About 2-[[2-[(4-methyl-1,3-thiazol-2-yl)amino]-4-pyridinyl]sulfanyl]phenol
2-[[2-[(4-methyl-1,3-thiazol-2-yl)amino]-4-pyridinyl]sulfanyl]phenol (PubChem CID 24826425) has the molecular formula C15H13N3OS2
and a molecular weight of 315.42 g/mol. Its IUPAC name is 2-[[2-[(4-methyl-1,3-thiazol-2-yl)amino]-4-pyridinyl]sulfanyl]phenol.
Molecular Properties
| Compound Name | 2-[[2-[(4-methyl-1,3-thiazol-2-yl)amino]-4-pyridinyl]sulfanyl]phenol |
| PubChem CID | 24826425 |
| Molecular Formula | C15H13N3OS2 |
| Molecular Weight | 315.42 g/mol |
| Exact Mass | 315.05 |
| IUPAC Name | 2-[[2-[(4-methyl-1,3-thiazol-2-yl)amino]-4-pyridinyl]sulfanyl]phenol |
| SMILES | Cc1csc(Nc2cc(Sc3ccccc3O)ccn2)n1 |
| InChI | InChI=1S/C15H13N3OS2/c1-10-9-20-15(17-10)18-14-8-11(6-7-16-14)21-13-5-3-2-4-12(13)19/h2-9,19H,1H3,(H,16,17,18) |
| InChIKey | JQWFNBNZEFFNDR-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.42 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[[2-[(4-methyl-1,3-thiazol-2-yl)amino]-4-pyridinyl]sulfanyl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[2-[(4-methyl-1,3-thiazol-2-yl)amino]-4-pyridinyl]sulfanyl]phenol?
The IUPAC name of 2-[[2-[(4-methyl-1,3-thiazol-2-yl)amino]-4-pyridinyl]sulfanyl]phenol (CID 24826425) is 2-[[2-[(4-methyl-1,3-thiazol-2-yl)amino]-4-pyridinyl]sulfanyl]phenol.
What is the SMILES notation for 2-[[2-[(4-methyl-1,3-thiazol-2-yl)amino]-4-pyridinyl]sulfanyl]phenol?
The canonical SMILES for 2-[[2-[(4-methyl-1,3-thiazol-2-yl)amino]-4-pyridinyl]sulfanyl]phenol is Cc1csc(Nc2cc(Sc3ccccc3O)ccn2)n1.
What is the InChIKey of 2-[[2-[(4-methyl-1,3-thiazol-2-yl)amino]-4-pyridinyl]sulfanyl]phenol?
The InChIKey is JQWFNBNZEFFNDR-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13N3OS2/c1-10-9-20-15(17-10)18-14-8-11(6-7-16-14)21-13-5-3-2-4-12(13)19/h2-9,19H,1H3,(H,16,17,18).
What are the key properties of 2-[[2-[(4-methyl-1,3-thiazol-2-yl)amino]-4-pyridinyl]sulfanyl]phenol?
2-[[2-[(4-methyl-1,3-thiazol-2-yl)amino]-4-pyridinyl]sulfanyl]phenol has a molecular weight of 315.42 g/mol, XLogP of 4.45, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[2-[(4-methyl-1,3-thiazol-2-yl)amino]-4-pyridinyl]sulfanyl]phenol is sourced from PubChem (CID 24826425), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).