C26H22N6O2 — CID 24827978
1-(10-acetyl-5,8-diphenyl-2,4,5,8,9,11-hexazatetracyclo[10.4.0.02,6.07,11]hexadeca-1(16),3,9,12,14-pentaen-3-yl)ethanone (PubChem CID 24827978) has the molecular formula C26H22N6O2 and a molecular weight of 450.50 g/mol. Its IUPAC name is 1-(10-acetyl-5,8-diphenyl-2,4,5,8,9,11-hexazatetracyclo[10.4.0.02,6.07,11]hexadeca-1(16),3,9,12,14-pentaen-3-yl)ethanone.
| Compound Name | 1-(10-acetyl-5,8-diphenyl-2,4,5,8,9,11-hexazatetracyclo[10.4.0.02,6.07,11]hexadeca-1(16),3,9,12,14-pentaen-3-yl)ethanone |
|---|---|
| PubChem CID | 24827978 |
| Molecular Formula | C26H22N6O2 |
| Molecular Weight | 450.50 g/mol |
| Exact Mass | 450.18 |
| IUPAC Name | 1-(10-acetyl-5,8-diphenyl-2,4,5,8,9,11-hexazatetracyclo[10.4.0.02,6.07,11]hexadeca-1(16),3,9,12,14-pentaen-3-yl)ethanone |
| SMILES | CC(=O)C1=NN(c2ccccc2)C2C3N(c4ccccc4)N=C(C(C)=O)N3c3ccccc3N12 |
| InChI | InChI=1S/C26H22N6O2/c1-17(33)23-27-31(19-11-5-3-6-12-19)25-26-30(22-16-10-9-15-21(22)29(23)25)24(18(2)34)28-32(26)20-13-7-4-8-14-20/h3-16,25-26H,1-2H3 |
| InChIKey | FSBXJBGXLSFBQW-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 71.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.50 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |