C24H23ClN4O2S — CID 56689910
1-[4-(3-chloro-4-morpholin-4-ylphenyl)-2-phenyl-3-thiophen-2-yl-3H-1,2,4-triazol-5-yl]ethanone (PubChem CID 56689910) has the molecular formula C24H23ClN4O2S and a molecular weight of 466.99 g/mol. Its IUPAC name is 1-[4-(3-chloro-4-morpholin-4-ylphenyl)-2-phenyl-3-thiophen-2-yl-3H-1,2,4-triazol-5-yl]ethanone.
| Compound Name | 1-[4-(3-chloro-4-morpholin-4-ylphenyl)-2-phenyl-3-thiophen-2-yl-3H-1,2,4-triazol-5-yl]ethanone |
|---|---|
| PubChem CID | 56689910 |
| Molecular Formula | C24H23ClN4O2S |
| Molecular Weight | 466.99 g/mol |
| Exact Mass | 466.12 |
| IUPAC Name | 1-[4-(3-chloro-4-morpholin-4-ylphenyl)-2-phenyl-3-thiophen-2-yl-3H-1,2,4-triazol-5-yl]ethanone |
| SMILES | CC(=O)C1=NN(c2ccccc2)C(c2cccs2)N1c1ccc(N2CCOCC2)c(Cl)c1 |
| InChI | InChI=1S/C24H23ClN4O2S/c1-17(30)23-26-29(18-6-3-2-4-7-18)24(22-8-5-15-32-22)28(23)19-9-10-21(20(25)16-19)27-11-13-31-14-12-27/h2-10,15-16,24H,11-14H2,1H3 |
| InChIKey | CRZQZUTWRUVLSA-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 48.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.99 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|