C25H24N4O3 — CID 171987609
1-[3-(1,3-benzodioxol-5-yl)-4-[4-(dimethylamino)phenyl]-2-phenyl-3H-1,2,4-triazol-5-yl]ethanone (PubChem CID 171987609) has the molecular formula C25H24N4O3 and a molecular weight of 428.49 g/mol. Its IUPAC name is 1-[3-(1,3-benzodioxol-5-yl)-4-[4-(dimethylamino)phenyl]-2-phenyl-3H-1,2,4-triazol-5-yl]ethanone.
| Compound Name | 1-[3-(1,3-benzodioxol-5-yl)-4-[4-(dimethylamino)phenyl]-2-phenyl-3H-1,2,4-triazol-5-yl]ethanone |
|---|---|
| PubChem CID | 171987609 |
| Molecular Formula | C25H24N4O3 |
| Molecular Weight | 428.49 g/mol |
| Exact Mass | 428.18 |
| IUPAC Name | 1-[3-(1,3-benzodioxol-5-yl)-4-[4-(dimethylamino)phenyl]-2-phenyl-3H-1,2,4-triazol-5-yl]ethanone |
| SMILES | CC(=O)C1=NN(c2ccccc2)C(c2ccc3c(c2)OCO3)N1c1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C25H24N4O3/c1-17(30)24-26-29(21-7-5-4-6-8-21)25(18-9-14-22-23(15-18)32-16-31-22)28(24)20-12-10-19(11-13-20)27(2)3/h4-15,25H,16H2,1-3H3 |
| InChIKey | CDAFLULMAOWILS-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 57.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.49 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|