C26H22N8O2 — CID 24830137
4-[3-[1-(4-methoxyphenyl)cyclopropyl]-[1,2,4]triazolo[4,3-b][1,2,4]triazin-6-yl]-N'-pyridin-2-ylbenzohydrazide (PubChem CID 24830137) has the molecular formula C26H22N8O2 and a molecular weight of 478.52 g/mol. Its IUPAC name is 4-[3-[1-(4-methoxyphenyl)cyclopropyl]-[1,2,4]triazolo[4,3-b][1,2,4]triazin-6-yl]-N'-pyridin-2-ylbenzohydrazide.
| Compound Name | 4-[3-[1-(4-methoxyphenyl)cyclopropyl]-[1,2,4]triazolo[4,3-b][1,2,4]triazin-6-yl]-N'-pyridin-2-ylbenzohydrazide |
|---|---|
| PubChem CID | 24830137 |
| Molecular Formula | C26H22N8O2 |
| Molecular Weight | 478.52 g/mol |
| Exact Mass | 478.19 |
| IUPAC Name | 4-[3-[1-(4-methoxyphenyl)cyclopropyl]-[1,2,4]triazolo[4,3-b][1,2,4]triazin-6-yl]-N'-pyridin-2-ylbenzohydrazide |
| SMILES | COc1ccc(C2(c3nnc4ncc(-c5ccc(C(=O)NNc6ccccn6)cc5)nn34)CC2)cc1 |
| InChI | InChI=1S/C26H22N8O2/c1-36-20-11-9-19(10-12-20)26(13-14-26)24-31-32-25-28-16-21(33-34(24)25)17-5-7-18(8-6-17)23(35)30-29-22-4-2-3-15-27-22/h2-12,15-16H,13-14H2,1H3,(H,27,29)(H,30,35) |
| InChIKey | BQARQYZDUQNZHV-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 119.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.52 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|