C27H24N2O4 — CID 24830945
(E)-3-(2,5-dimethoxyphenyl)-N-[4-[2-methyl-5-(1,3-oxazol-2-yl)phenyl]phenyl]prop-2-enamide (PubChem CID 24830945) has the molecular formula C27H24N2O4 and a molecular weight of 440.50 g/mol. Its IUPAC name is (E)-3-(2,5-dimethoxyphenyl)-N-[4-[2-methyl-5-(1,3-oxazol-2-yl)phenyl]phenyl]prop-2-enamide.
| Compound Name | (E)-3-(2,5-dimethoxyphenyl)-N-[4-[2-methyl-5-(1,3-oxazol-2-yl)phenyl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 24830945 |
| Molecular Formula | C27H24N2O4 |
| Molecular Weight | 440.50 g/mol |
| Exact Mass | 440.17 |
| IUPAC Name | (E)-3-(2,5-dimethoxyphenyl)-N-[4-[2-methyl-5-(1,3-oxazol-2-yl)phenyl]phenyl]prop-2-enamide |
| SMILES | COc1ccc(OC)c(/C=C/C(=O)Nc2ccc(-c3cc(-c4ncco4)ccc3C)cc2)c1 |
| InChI | InChI=1S/C27H24N2O4/c1-18-4-5-21(27-28-14-15-33-27)17-24(18)19-6-9-22(10-7-19)29-26(30)13-8-20-16-23(31-2)11-12-25(20)32-3/h4-17H,1-3H3,(H,29,30)/b13-8+ |
| InChIKey | GKECJKFMDAFING-MDWZMJQESA-N |
| XLogP | 5.99 |
| TPSA | 73.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.50 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|