C25H18F2N2O2 — CID 69285195
3-(2,6-difluorophenyl)-N-[4-[2-methyl-5-(1,3-oxazol-2-yl)phenyl]phenyl]prop-2-enamide (PubChem CID 69285195) has the molecular formula C25H18F2N2O2 and a molecular weight of 416.43 g/mol. Its IUPAC name is 3-(2,6-difluorophenyl)-N-[4-[2-methyl-5-(1,3-oxazol-2-yl)phenyl]phenyl]prop-2-enamide.
| Compound Name | 3-(2,6-difluorophenyl)-N-[4-[2-methyl-5-(1,3-oxazol-2-yl)phenyl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 69285195 |
| Molecular Formula | C25H18F2N2O2 |
| Molecular Weight | 416.43 g/mol |
| Exact Mass | 416.13 |
| IUPAC Name | 3-(2,6-difluorophenyl)-N-[4-[2-methyl-5-(1,3-oxazol-2-yl)phenyl]phenyl]prop-2-enamide |
| SMILES | Cc1ccc(-c2ncco2)cc1-c1ccc(NC(=O)C=Cc2c(F)cccc2F)cc1 |
| InChI | InChI=1S/C25H18F2N2O2/c1-16-5-6-18(25-28-13-14-31-25)15-21(16)17-7-9-19(10-8-17)29-24(30)12-11-20-22(26)3-2-4-23(20)27/h2-15H,1H3,(H,29,30) |
| InChIKey | OTTBPDJHZYHBDV-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.43 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|