C20H13F2N5O2 — CID 118378708
2,3-difluoro-N-[5-[2-methyl-5-(1,3-oxazol-2-yl)phenyl]pyrazin-2-yl]pyridine-4-carboxamide (PubChem CID 118378708) has the molecular formula C20H13F2N5O2 and a molecular weight of 393.35 g/mol. Its IUPAC name is 2,3-difluoro-N-[5-[2-methyl-5-(1,3-oxazol-2-yl)phenyl]pyrazin-2-yl]pyridine-4-carboxamide.
| Compound Name | 2,3-difluoro-N-[5-[2-methyl-5-(1,3-oxazol-2-yl)phenyl]pyrazin-2-yl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 118378708 |
| Molecular Formula | C20H13F2N5O2 |
| Molecular Weight | 393.35 g/mol |
| Exact Mass | 393.10 |
| IUPAC Name | 2,3-difluoro-N-[5-[2-methyl-5-(1,3-oxazol-2-yl)phenyl]pyrazin-2-yl]pyridine-4-carboxamide |
| SMILES | Cc1ccc(-c2ncco2)cc1-c1cnc(NC(=O)c2ccnc(F)c2F)cn1 |
| InChI | InChI=1S/C20H13F2N5O2/c1-11-2-3-12(20-24-6-7-29-20)8-14(11)15-9-26-16(10-25-15)27-19(28)13-4-5-23-18(22)17(13)21/h2-10H,1H3,(H,26,27,28) |
| InChIKey | DUFIXPYOQHOCLJ-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 93.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.35 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|