C14H10F2N8O3 — CID 175412728
[5-[5-[(2,3-difluoropyridine-4-carbonyl)amino]pyrazin-2-yl]-3-methyltriazol-4-yl] carbamate (PubChem CID 175412728) has the molecular formula C14H10F2N8O3 and a molecular weight of 376.28 g/mol. Its IUPAC name is [5-[5-[(2,3-difluoropyridine-4-carbonyl)amino]pyrazin-2-yl]-3-methyltriazol-4-yl] carbamate.
| Compound Name | [5-[5-[(2,3-difluoropyridine-4-carbonyl)amino]pyrazin-2-yl]-3-methyltriazol-4-yl] carbamate |
|---|---|
| PubChem CID | 175412728 |
| Molecular Formula | C14H10F2N8O3 |
| Molecular Weight | 376.28 g/mol |
| Exact Mass | 376.08 |
| IUPAC Name | [5-[5-[(2,3-difluoropyridine-4-carbonyl)amino]pyrazin-2-yl]-3-methyltriazol-4-yl] carbamate |
| SMILES | Cn1nnc(-c2cnc(NC(=O)c3ccnc(F)c3F)cn2)c1OC(N)=O |
| InChI | InChI=1S/C14H10F2N8O3/c1-24-13(27-14(17)26)10(22-23-24)7-4-20-8(5-19-7)21-12(25)6-2-3-18-11(16)9(6)15/h2-5H,1H3,(H2,17,26)(H,20,21,25) |
| InChIKey | ITGBIGGEGIBZCM-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 150.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.28 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|