About (4-methylthiadiazol-5-yl) N-[5-[2-methyl-5-(1,3-oxazol-2-yl)phenyl]-2-pyridinyl]carbamate
(4-methylthiadiazol-5-yl) N-[5-[2-methyl-5-(1,3-oxazol-2-yl)phenyl]-2-pyridinyl]carbamate (PubChem CID 71205541) has the molecular formula C19H15N5O3S
and a molecular weight of 393.43 g/mol. Its IUPAC name is (4-methylthiadiazol-5-yl) N-[5-[2-methyl-5-(1,3-oxazol-2-yl)phenyl]-2-pyridinyl]carbamate.
Molecular Properties
| Compound Name | (4-methylthiadiazol-5-yl) N-[5-[2-methyl-5-(1,3-oxazol-2-yl)phenyl]-2-pyridinyl]carbamate |
| PubChem CID | 71205541 |
| Molecular Formula | C19H15N5O3S |
| Molecular Weight | 393.43 g/mol |
| Exact Mass | 393.09 |
| IUPAC Name | (4-methylthiadiazol-5-yl) N-[5-[2-methyl-5-(1,3-oxazol-2-yl)phenyl]-2-pyridinyl]carbamate |
| SMILES | Cc1ccc(-c2ncco2)cc1-c1ccc(NC(=O)Oc2snnc2C)nc1 |
| InChI | InChI=1S/C19H15N5O3S/c1-11-3-4-13(17-20-7-8-26-17)9-15(11)14-5-6-16(21-10-14)22-19(25)27-18-12(2)23-24-28-18/h3-10H,1-2H3,(H,21,22,25) |
| InChIKey | PMVKCQVWAIXDGW-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 103.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 393.43 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze (4-methylthiadiazol-5-yl) N-[5-[2-methyl-5-(1,3-oxazol-2-yl)phenyl]-2-pyridinyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-methylthiadiazol-5-yl) N-[5-[2-methyl-5-(1,3-oxazol-2-yl)phenyl]-2-pyridinyl]carbamate?
The IUPAC name of (4-methylthiadiazol-5-yl) N-[5-[2-methyl-5-(1,3-oxazol-2-yl)phenyl]-2-pyridinyl]carbamate (CID 71205541) is (4-methylthiadiazol-5-yl) N-[5-[2-methyl-5-(1,3-oxazol-2-yl)phenyl]-2-pyridinyl]carbamate.
What is the SMILES notation for (4-methylthiadiazol-5-yl) N-[5-[2-methyl-5-(1,3-oxazol-2-yl)phenyl]-2-pyridinyl]carbamate?
The canonical SMILES for (4-methylthiadiazol-5-yl) N-[5-[2-methyl-5-(1,3-oxazol-2-yl)phenyl]-2-pyridinyl]carbamate is Cc1ccc(-c2ncco2)cc1-c1ccc(NC(=O)Oc2snnc2C)nc1.
What is the InChIKey of (4-methylthiadiazol-5-yl) N-[5-[2-methyl-5-(1,3-oxazol-2-yl)phenyl]-2-pyridinyl]carbamate?
The InChIKey is PMVKCQVWAIXDGW-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H15N5O3S/c1-11-3-4-13(17-20-7-8-26-17)9-15(11)14-5-6-16(21-10-14)22-19(25)27-18-12(2)23-24-28-18/h3-10H,1-2H3,(H,21,22,25).
What are the key properties of (4-methylthiadiazol-5-yl) N-[5-[2-methyl-5-(1,3-oxazol-2-yl)phenyl]-2-pyridinyl]carbamate?
(4-methylthiadiazol-5-yl) N-[5-[2-methyl-5-(1,3-oxazol-2-yl)phenyl]-2-pyridinyl]carbamate has a molecular weight of 393.43 g/mol, XLogP of 4.48, 4 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for (4-methylthiadiazol-5-yl) N-[5-[2-methyl-5-(1,3-oxazol-2-yl)phenyl]-2-pyridinyl]carbamate is sourced from PubChem (CID 71205541), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).