C19H12Cl2FN5 — CID 24831898
3-[1-(2,4-dichlorophenyl)cyclopropyl]-6-(4-fluorophenyl)-[1,2,4]triazolo[4,3-b][1,2,4]triazine (PubChem CID 24831898) has the molecular formula C19H12Cl2FN5 and a molecular weight of 400.24 g/mol. Its IUPAC name is 3-[1-(2,4-dichlorophenyl)cyclopropyl]-6-(4-fluorophenyl)-[1,2,4]triazolo[4,3-b][1,2,4]triazine.
| Compound Name | 3-[1-(2,4-dichlorophenyl)cyclopropyl]-6-(4-fluorophenyl)-[1,2,4]triazolo[4,3-b][1,2,4]triazine |
|---|---|
| PubChem CID | 24831898 |
| Molecular Formula | C19H12Cl2FN5 |
| Molecular Weight | 400.24 g/mol |
| Exact Mass | 399.05 |
| IUPAC Name | 3-[1-(2,4-dichlorophenyl)cyclopropyl]-6-(4-fluorophenyl)-[1,2,4]triazolo[4,3-b][1,2,4]triazine |
| SMILES | Fc1ccc(-c2cnc3nnc(C4(c5ccc(Cl)cc5Cl)CC4)n3n2)cc1 |
| InChI | InChI=1S/C19H12Cl2FN5/c20-12-3-6-14(15(21)9-12)19(7-8-19)17-24-25-18-23-10-16(26-27(17)18)11-1-4-13(22)5-2-11/h1-6,9-10H,7-8H2 |
| InChIKey | JJLHGGSYXFMMLR-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 55.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.24 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |