C28H26O13 — CID 24833799
[(3R,6S)-4,5,6-triacetyloxy-2-[(8-hydroxy-9,10-dioxoanthracen-1-yl)oxymethyl]oxan-3-yl] acetate (PubChem CID 24833799) has the molecular formula C28H26O13 and a molecular weight of 570.50 g/mol. Its IUPAC name is [(3R,6S)-4,5,6-triacetyloxy-2-[(8-hydroxy-9,10-dioxoanthracen-1-yl)oxymethyl]oxan-3-yl] acetate.
| Compound Name | [(3R,6S)-4,5,6-triacetyloxy-2-[(8-hydroxy-9,10-dioxoanthracen-1-yl)oxymethyl]oxan-3-yl] acetate |
|---|---|
| PubChem CID | 24833799 |
| Molecular Formula | C28H26O13 |
| Molecular Weight | 570.50 g/mol |
| Exact Mass | 570.14 |
| IUPAC Name | [(3R,6S)-4,5,6-triacetyloxy-2-[(8-hydroxy-9,10-dioxoanthracen-1-yl)oxymethyl]oxan-3-yl] acetate |
| SMILES | CC(=O)OC1C(OC(C)=O)[C@H](OC(C)=O)C(COc2cccc3c2C(=O)c2c(O)cccc2C3=O)O[C@H]1OC(C)=O |
| InChI | InChI=1S/C28H26O13/c1-12(29)37-25-20(41-28(40-15(4)32)27(39-14(3)31)26(25)38-13(2)30)11-36-19-10-6-8-17-22(19)24(35)21-16(23(17)34)7-5-9-18(21)33/h5-10,20,25-28,33H,11H2,1-4H3/t20?,25-,26?,27?,28-/m1/s1 |
| InChIKey | AXCOBSXMALNMSG-DMLVCVQUSA-N |
| XLogP | 1.63 |
| TPSA | 178.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.50 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|