C15H12N2O3 — CID 24835581
6-[(E)-C-benzyl-N-hydroxycarbonimidoyl]-3H-1,3-benzoxazol-2-one (PubChem CID 24835581) has the molecular formula C15H12N2O3 and a molecular weight of 268.27 g/mol. Its IUPAC name is 6-[(E)-C-benzyl-N-hydroxycarbonimidoyl]-3H-1,3-benzoxazol-2-one.
| Compound Name | 6-[(E)-C-benzyl-N-hydroxycarbonimidoyl]-3H-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 24835581 |
| Molecular Formula | C15H12N2O3 |
| Molecular Weight | 268.27 g/mol |
| Exact Mass | 268.08 |
| IUPAC Name | 6-[(E)-C-benzyl-N-hydroxycarbonimidoyl]-3H-1,3-benzoxazol-2-one |
| SMILES | O=c1[nH]c2ccc(/C(Cc3ccccc3)=N/O)cc2o1 |
| InChI | InChI=1S/C15H12N2O3/c18-15-16-12-7-6-11(9-14(12)20-15)13(17-19)8-10-4-2-1-3-5-10/h1-7,9,19H,8H2,(H,16,18)/b17-13+ |
| InChIKey | GHRGXEQBXYSZOF-GHRIWEEISA-N |
| XLogP | 2.54 |
| TPSA | 78.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.27 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|