About bis([2-(3,5-dihydroxyphenyl)-2-hydroxyethyl]-propan-2-ylazanium);sulfate
bis([2-(3,5-dihydroxyphenyl)-2-hydroxyethyl]-propan-2-ylazanium);sulfate (PubChem CID 24835641) has the molecular formula C22H36N2O10S
and a molecular weight of 520.60 g/mol. Its IUPAC name is bis([2-(3,5-dihydroxyphenyl)-2-hydroxyethyl]-propan-2-ylazanium);sulfate.
Molecular Properties
| Compound Name | bis([2-(3,5-dihydroxyphenyl)-2-hydroxyethyl]-propan-2-ylazanium);sulfate |
| PubChem CID | 24835641 |
| Molecular Formula | C22H36N2O10S |
| Molecular Weight | 520.60 g/mol |
| Exact Mass | 520.21 |
| IUPAC Name | bis([2-(3,5-dihydroxyphenyl)-2-hydroxyethyl]-propan-2-ylazanium);sulfate |
| SMILES | CC(C)[NH2+]CC(O)c1cc(O)cc(O)c1.CC(C)[NH2+]CC(O)c1cc(O)cc(O)c1.O=S(=O)([O-])[O-] |
| InChI | InChI=1S/2C11H17NO3.H2O4S/c2*1-7(2)12-6-11(15)8-3-9(13)5-10(14)4-8;1-5(2,3)4/h2*3-5,7,11-15H,6H2,1-2H3;(H2,1,2,3,4) |
| InChIKey | MKFFGUZYVNDHIH-UHFFFAOYSA-N |
| XLogP | -1.13 |
| TPSA | 234.86 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 520.60 |
| LogP ≤ 5 | -1.13 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|
Analyze bis([2-(3,5-dihydroxyphenyl)-2-hydroxyethyl]-propan-2-ylazanium);sulfate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis([2-(3,5-dihydroxyphenyl)-2-hydroxyethyl]-propan-2-ylazanium);sulfate?
The IUPAC name of bis([2-(3,5-dihydroxyphenyl)-2-hydroxyethyl]-propan-2-ylazanium);sulfate (CID 24835641) is bis([2-(3,5-dihydroxyphenyl)-2-hydroxyethyl]-propan-2-ylazanium);sulfate.
What is the SMILES notation for bis([2-(3,5-dihydroxyphenyl)-2-hydroxyethyl]-propan-2-ylazanium);sulfate?
The canonical SMILES for bis([2-(3,5-dihydroxyphenyl)-2-hydroxyethyl]-propan-2-ylazanium);sulfate is CC(C)[NH2+]CC(O)c1cc(O)cc(O)c1.CC(C)[NH2+]CC(O)c1cc(O)cc(O)c1.O=S(=O)([O-])[O-].
What is the InChIKey of bis([2-(3,5-dihydroxyphenyl)-2-hydroxyethyl]-propan-2-ylazanium);sulfate?
The InChIKey is MKFFGUZYVNDHIH-UHFFFAOYSA-N. The full InChI is InChI=1S/2C11H17NO3.H2O4S/c2*1-7(2)12-6-11(15)8-3-9(13)5-10(14)4-8;1-5(2,3)4/h2*3-5,7,11-15H,6H2,1-2H3;(H2,1,2,3,4).
What are the key properties of bis([2-(3,5-dihydroxyphenyl)-2-hydroxyethyl]-propan-2-ylazanium);sulfate?
bis([2-(3,5-dihydroxyphenyl)-2-hydroxyethyl]-propan-2-ylazanium);sulfate has a molecular weight of 520.60 g/mol, XLogP of -1.13, 8 rotatable bonds, 8 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for bis([2-(3,5-dihydroxyphenyl)-2-hydroxyethyl]-propan-2-ylazanium);sulfate is sourced from PubChem (CID 24835641), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).