About bis(tert-butyl-[2-(3,4-dihydroxyphenyl)-2-hydroxyethyl]azanium);sulfate
bis(tert-butyl-[2-(3,4-dihydroxyphenyl)-2-hydroxyethyl]azanium);sulfate (PubChem CID 164512046) has the molecular formula C24H40N2O10S
and a molecular weight of 548.66 g/mol. Its IUPAC name is bis(tert-butyl-[2-(3,4-dihydroxyphenyl)-2-hydroxyethyl]azanium);sulfate.
Molecular Properties
| Compound Name | bis(tert-butyl-[2-(3,4-dihydroxyphenyl)-2-hydroxyethyl]azanium);sulfate |
| PubChem CID | 164512046 |
| Molecular Formula | C24H40N2O10S |
| Molecular Weight | 548.66 g/mol |
| Exact Mass | 548.24 |
| IUPAC Name | bis(tert-butyl-[2-(3,4-dihydroxyphenyl)-2-hydroxyethyl]azanium);sulfate |
| SMILES | CC(C)(C)[NH2+]CC(O)c1ccc(O)c(O)c1.CC(C)(C)[NH2+]CC(O)c1ccc(O)c(O)c1.O=S(=O)([O-])[O-] |
| InChI | InChI=1S/2C12H19NO3.H2O4S/c2*1-12(2,3)13-7-11(16)8-4-5-9(14)10(15)6-8;1-5(2,3)4/h2*4-6,11,13-16H,7H2,1-3H3;(H2,1,2,3,4) |
| InChIKey | QJEWQPHCPCRSAP-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 234.86 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 548.66 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|
Analyze bis(tert-butyl-[2-(3,4-dihydroxyphenyl)-2-hydroxyethyl]azanium);sulfate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(tert-butyl-[2-(3,4-dihydroxyphenyl)-2-hydroxyethyl]azanium);sulfate?
The IUPAC name of bis(tert-butyl-[2-(3,4-dihydroxyphenyl)-2-hydroxyethyl]azanium);sulfate (CID 164512046) is bis(tert-butyl-[2-(3,4-dihydroxyphenyl)-2-hydroxyethyl]azanium);sulfate.
What is the SMILES notation for bis(tert-butyl-[2-(3,4-dihydroxyphenyl)-2-hydroxyethyl]azanium);sulfate?
The canonical SMILES for bis(tert-butyl-[2-(3,4-dihydroxyphenyl)-2-hydroxyethyl]azanium);sulfate is CC(C)(C)[NH2+]CC(O)c1ccc(O)c(O)c1.CC(C)(C)[NH2+]CC(O)c1ccc(O)c(O)c1.O=S(=O)([O-])[O-].
What is the InChIKey of bis(tert-butyl-[2-(3,4-dihydroxyphenyl)-2-hydroxyethyl]azanium);sulfate?
The InChIKey is QJEWQPHCPCRSAP-UHFFFAOYSA-N. The full InChI is InChI=1S/2C12H19NO3.H2O4S/c2*1-12(2,3)13-7-11(16)8-4-5-9(14)10(15)6-8;1-5(2,3)4/h2*4-6,11,13-16H,7H2,1-3H3;(H2,1,2,3,4).
What are the key properties of bis(tert-butyl-[2-(3,4-dihydroxyphenyl)-2-hydroxyethyl]azanium);sulfate?
bis(tert-butyl-[2-(3,4-dihydroxyphenyl)-2-hydroxyethyl]azanium);sulfate has a molecular weight of 548.66 g/mol, XLogP of -0.35, 6 rotatable bonds, 8 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for bis(tert-butyl-[2-(3,4-dihydroxyphenyl)-2-hydroxyethyl]azanium);sulfate is sourced from PubChem (CID 164512046), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).