C19H22N4O3S — CID 24838777
1-[[4-(2-methylpropoxy)phenyl]methyl]-3-[(Z)-(3-nitrophenyl)methylideneamino]thiourea (PubChem CID 24838777) has the molecular formula C19H22N4O3S and a molecular weight of 386.48 g/mol. Its IUPAC name is 1-[[4-(2-methylpropoxy)phenyl]methyl]-3-[(Z)-(3-nitrophenyl)methylideneamino]thiourea.
| Compound Name | 1-[[4-(2-methylpropoxy)phenyl]methyl]-3-[(Z)-(3-nitrophenyl)methylideneamino]thiourea |
|---|---|
| PubChem CID | 24838777 |
| Molecular Formula | C19H22N4O3S |
| Molecular Weight | 386.48 g/mol |
| Exact Mass | 386.14 |
| IUPAC Name | 1-[[4-(2-methylpropoxy)phenyl]methyl]-3-[(Z)-(3-nitrophenyl)methylideneamino]thiourea |
| SMILES | CC(C)COc1ccc(CNC(=S)N/N=C\c2cccc([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C19H22N4O3S/c1-14(2)13-26-18-8-6-15(7-9-18)11-20-19(27)22-21-12-16-4-3-5-17(10-16)23(24)25/h3-10,12,14H,11,13H2,1-2H3,(H2,20,22,27)/b21-12- |
| InChIKey | LNKGWGUMJGGDKI-MTJSOVHGSA-N |
| XLogP | 3.63 |
| TPSA | 88.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.48 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|