About (2-azanidylcyclohexyl)azanide;2-(carboxylatomethyl)-4-nitrobenzoate;platinum(4+)
(2-azanidylcyclohexyl)azanide;2-(carboxylatomethyl)-4-nitrobenzoate;platinum(4+) (PubChem CID 24843067) has the molecular formula C15H17N3O6Pt
and a molecular weight of 530.39 g/mol. Its IUPAC name is (2-azanidylcyclohexyl)azanide;2-(carboxylatomethyl)-4-nitrobenzoate;platinum(4+).
Molecular Properties
| Compound Name | (2-azanidylcyclohexyl)azanide;2-(carboxylatomethyl)-4-nitrobenzoate;platinum(4+) |
| PubChem CID | 24843067 |
| Molecular Formula | C15H17N3O6Pt |
| Molecular Weight | 530.39 g/mol |
| Exact Mass | 530.08 |
| IUPAC Name | (2-azanidylcyclohexyl)azanide;2-(carboxylatomethyl)-4-nitrobenzoate;platinum(4+) |
| SMILES | O=C([O-])Cc1cc([N+](=O)[O-])ccc1C(=O)[O-].[NH-]C1CCCCC1[NH-].[Pt+4] |
| InChI | InChI=1S/C9H7NO6.C6H12N2.Pt/c11-8(12)4-5-3-6(10(15)16)1-2-7(5)9(13)14;7-5-3-1-2-4-6(5)8;/h1-3H,4H2,(H,11,12)(H,13,14);5-8H,1-4H2;/q;-2;+4/p-2 |
| InChIKey | SVVOSDIMDXZTBA-UHFFFAOYSA-L |
| XLogP | 0.65 |
| TPSA | 171.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 530.39 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (2-azanidylcyclohexyl)azanide;2-(carboxylatomethyl)-4-nitrobenzoate;platinum(4+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-azanidylcyclohexyl)azanide;2-(carboxylatomethyl)-4-nitrobenzoate;platinum(4+)?
The IUPAC name of (2-azanidylcyclohexyl)azanide;2-(carboxylatomethyl)-4-nitrobenzoate;platinum(4+) (CID 24843067) is (2-azanidylcyclohexyl)azanide;2-(carboxylatomethyl)-4-nitrobenzoate;platinum(4+).
What is the SMILES notation for (2-azanidylcyclohexyl)azanide;2-(carboxylatomethyl)-4-nitrobenzoate;platinum(4+)?
The canonical SMILES for (2-azanidylcyclohexyl)azanide;2-(carboxylatomethyl)-4-nitrobenzoate;platinum(4+) is O=C([O-])Cc1cc([N+](=O)[O-])ccc1C(=O)[O-].[NH-]C1CCCCC1[NH-].[Pt+4].
What is the InChIKey of (2-azanidylcyclohexyl)azanide;2-(carboxylatomethyl)-4-nitrobenzoate;platinum(4+)?
The InChIKey is SVVOSDIMDXZTBA-UHFFFAOYSA-L. The full InChI is InChI=1S/C9H7NO6.C6H12N2.Pt/c11-8(12)4-5-3-6(10(15)16)1-2-7(5)9(13)14;7-5-3-1-2-4-6(5)8;/h1-3H,4H2,(H,11,12)(H,13,14);5-8H,1-4H2;/q;-2;+4/p-2.
What are the key properties of (2-azanidylcyclohexyl)azanide;2-(carboxylatomethyl)-4-nitrobenzoate;platinum(4+)?
(2-azanidylcyclohexyl)azanide;2-(carboxylatomethyl)-4-nitrobenzoate;platinum(4+) has a molecular weight of 530.39 g/mol, XLogP of 0.65, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2-azanidylcyclohexyl)azanide;2-(carboxylatomethyl)-4-nitrobenzoate;platinum(4+) is sourced from PubChem (CID 24843067), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).