C15H17N3O6Pt — CID 24843064
(2-azanidylcyclohexyl)azanide;2-(carboxylatomethyl)-6-nitrobenzoate;platinum(4+) (PubChem CID 24843064) has the molecular formula C15H17N3O6Pt and a molecular weight of 530.39 g/mol. Its IUPAC name is (2-azanidylcyclohexyl)azanide;2-(carboxylatomethyl)-6-nitrobenzoate;platinum(4+).
| Compound Name | (2-azanidylcyclohexyl)azanide;2-(carboxylatomethyl)-6-nitrobenzoate;platinum(4+) |
|---|---|
| PubChem CID | 24843064 |
| Molecular Formula | C15H17N3O6Pt |
| Molecular Weight | 530.39 g/mol |
| Exact Mass | 530.08 |
| IUPAC Name | (2-azanidylcyclohexyl)azanide;2-(carboxylatomethyl)-6-nitrobenzoate;platinum(4+) |
| SMILES | O=C([O-])Cc1cccc([N+](=O)[O-])c1C(=O)[O-].[NH-]C1CCCCC1[NH-].[Pt+4] |
| InChI | InChI=1S/C9H7NO6.C6H12N2.Pt/c11-7(12)4-5-2-1-3-6(10(15)16)8(5)9(13)14;7-5-3-1-2-4-6(5)8;/h1-3H,4H2,(H,11,12)(H,13,14);5-8H,1-4H2;/q;-2;+4/p-2 |
| InChIKey | BTUCGMCAMMLCJW-UHFFFAOYSA-L |
| XLogP | 0.65 |
| TPSA | 171.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.39 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|