C21H28O4 — CID 24843161
(1S,2S,3R,11S,12S,15S,16R,19R)-16-hydroxy-3,16-dimethyl-17,21-dioxahexacyclo[16.2.1.02,11.03,8.012,19.015,19]henicos-7-en-6-one (PubChem CID 24843161) has the molecular formula C21H28O4 and a molecular weight of 344.45 g/mol. Its IUPAC name is (1S,2S,3R,11S,12S,15S,16R,19R)-16-hydroxy-3,16-dimethyl-17,21-dioxahexacyclo[16.2.1.02,11.03,8.012,19.015,19]henicos-7-en-6-one.
| Compound Name | (1S,2S,3R,11S,12S,15S,16R,19R)-16-hydroxy-3,16-dimethyl-17,21-dioxahexacyclo[16.2.1.02,11.03,8.012,19.015,19]henicos-7-en-6-one |
|---|---|
| PubChem CID | 24843161 |
| Molecular Formula | C21H28O4 |
| Molecular Weight | 344.45 g/mol |
| Exact Mass | 344.20 |
| IUPAC Name | (1S,2S,3R,11S,12S,15S,16R,19R)-16-hydroxy-3,16-dimethyl-17,21-dioxahexacyclo[16.2.1.02,11.03,8.012,19.015,19]henicos-7-en-6-one |
| SMILES | C[C@]12CCC(=O)C=C1CC[C@@H]1[C@@H]2[C@@H]2C[C@]34C(O2)O[C@@](C)(O)[C@H]3CC[C@@H]14 |
| InChI | InChI=1S/C21H28O4/c1-19-8-7-12(22)9-11(19)3-4-13-14-5-6-16-20(2,23)25-18-21(14,16)10-15(24-18)17(13)19/h9,13-18,23H,3-8,10H2,1-2H3/t13-,14-,15-,16+,17+,18?,19-,20+,21+/m0/s1 |
| InChIKey | PCEZFEZUZMKEGF-KEDSRXHPSA-N |
| XLogP | 3.19 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.45 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |