C13H18ClNOS2 — CID 24843505
2-(dimethylamino)-1,1-dithiophen-2-ylpropan-1-ol;hydrochloride (PubChem CID 24843505) has the molecular formula C13H18ClNOS2 and a molecular weight of 303.88 g/mol. Its IUPAC name is 2-(dimethylamino)-1,1-dithiophen-2-ylpropan-1-ol;hydrochloride.
| Compound Name | 2-(dimethylamino)-1,1-dithiophen-2-ylpropan-1-ol;hydrochloride |
|---|---|
| PubChem CID | 24843505 |
| Molecular Formula | C13H18ClNOS2 |
| Molecular Weight | 303.88 g/mol |
| Exact Mass | 303.05 |
| IUPAC Name | 2-(dimethylamino)-1,1-dithiophen-2-ylpropan-1-ol;hydrochloride |
| SMILES | CC(N(C)C)C(O)(c1cccs1)c1cccs1.Cl |
| InChI | InChI=1S/C13H17NOS2.ClH/c1-10(14(2)3)13(15,11-6-4-8-16-11)12-7-5-9-17-12;/h4-10,15H,1-3H3;1H |
| InChIKey | RJWNKTGVXLPBFE-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.88 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |